C13H16N2O4 — CID 171897537
ethyl 3,4-dihydroxy-4-(1H-pyrrolo[2,3-b]pyridin-5-yl)butanoate (PubChem CID 171897537) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is ethyl 3,4-dihydroxy-4-(1H-pyrrolo[2,3-b]pyridin-5-yl)butanoate.
| Compound Name | ethyl 3,4-dihydroxy-4-(1H-pyrrolo[2,3-b]pyridin-5-yl)butanoate |
|---|---|
| PubChem CID | 171897537 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | ethyl 3,4-dihydroxy-4-(1H-pyrrolo[2,3-b]pyridin-5-yl)butanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C13H16N2O4/c1-2-19-11(17)6-10(16)12(18)9-5-8-3-4-14-13(8)15-7-9/h3-5,7,10,12,16,18H,2,6H2,1H3,(H,14,15) |
| InChIKey | AHFCFCAJSONMHK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |