C11H17N3O4 — CID 171897191
ethyl 4-(6-hydrazinyl-3-pyridinyl)-3,4-dihydroxybutanoate (PubChem CID 171897191) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is ethyl 4-(6-hydrazinyl-3-pyridinyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(6-hydrazinyl-3-pyridinyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171897191 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | ethyl 4-(6-hydrazinyl-3-pyridinyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc(NN)nc1 |
| InChI | InChI=1S/C11H17N3O4/c1-2-18-10(16)5-8(15)11(17)7-3-4-9(14-12)13-6-7/h3-4,6,8,11,15,17H,2,5,12H2,1H3,(H,13,14) |
| InChIKey | JLBZUNZRHWWNTG-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|