C10H15N3O4 — CID 171895400
methyl 4-(6-hydrazinyl-3-pyridinyl)-3,4-dihydroxybutanoate (PubChem CID 171895400) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is methyl 4-(6-hydrazinyl-3-pyridinyl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(6-hydrazinyl-3-pyridinyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171895400 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | methyl 4-(6-hydrazinyl-3-pyridinyl)-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1ccc(NN)nc1 |
| InChI | InChI=1S/C10H15N3O4/c1-17-9(15)4-7(14)10(16)6-2-3-8(13-11)12-5-6/h2-3,5,7,10,14,16H,4,11H2,1H3,(H,12,13) |
| InChIKey | CLUTXQAIRAJVRZ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|