C9H13N3O4 — CID 171895107
methyl 4-(2-aminopyrimidin-5-yl)-3,4-dihydroxybutanoate (PubChem CID 171895107) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is methyl 4-(2-aminopyrimidin-5-yl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(2-aminopyrimidin-5-yl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171895107 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | methyl 4-(2-aminopyrimidin-5-yl)-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1cnc(N)nc1 |
| InChI | InChI=1S/C9H13N3O4/c1-16-7(14)2-6(13)8(15)5-3-11-9(10)12-4-5/h3-4,6,8,13,15H,2H2,1H3,(H2,10,11,12) |
| InChIKey | SDXFLFGQLKDRQU-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |