C10H13N3O6 — CID 171896095
methyl 4-(2-amino-5-nitro-3-pyridinyl)-3,4-dihydroxybutanoate (PubChem CID 171896095) has the molecular formula C10H13N3O6 and a molecular weight of 271.23 g/mol. Its IUPAC name is methyl 4-(2-amino-5-nitro-3-pyridinyl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(2-amino-5-nitro-3-pyridinyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171896095 |
| Molecular Formula | C10H13N3O6 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | methyl 4-(2-amino-5-nitro-3-pyridinyl)-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1cc([N+](=O)[O-])cnc1N |
| InChI | InChI=1S/C10H13N3O6/c1-19-8(15)3-7(14)9(16)6-2-5(13(17)18)4-12-10(6)11/h2,4,7,9,14,16H,3H2,1H3,(H2,11,12) |
| InChIKey | IJQYSMFWIFBZDU-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 148.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|