C8H11N3O6 — CID 171895403
methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate (PubChem CID 171895403) has the molecular formula C8H11N3O6 and a molecular weight of 245.19 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate.
| Compound Name | methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate |
|---|---|
| PubChem CID | 171895403 |
| Molecular Formula | C8H11N3O6 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate |
| SMILES | COC(=O)CC(O)C(O)c1ncc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C8H11N3O6/c1-17-6(13)2-4(12)7(14)8-9-3-5(10-8)11(15)16/h3-4,7,12,14H,2H2,1H3,(H,9,10) |
| InChIKey | PJRALQRXPRBTIZ-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 138.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|