methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate

C8H11N3O6 — CID 171895403

IUPACmethyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate
SMILESCOC(=O)CC(O)C(O)c1ncc([N+](=O)[O-])[nH]1
InChIInChI=1S/C8H11N3O6/c1-17-6(13)2-4(12)7(14)8-9-3-5(10-8)11(15)16/h3-4,7,12,14H,2H2,1H3,(H,9,10)
InChIKeyPJRALQRXPRBTIZ-UHFFFAOYSA-N
MW245.19 g/mol
LogP-0.72
Rot. Bonds5

About methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate

methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate (PubChem CID 171895403) has the molecular formula C8H11N3O6 and a molecular weight of 245.19 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate.

Molecular Properties

Compound Namemethyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate
PubChem CID171895403
Molecular FormulaC8H11N3O6
Molecular Weight245.19 g/mol
Exact Mass245.06
IUPAC Namemethyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate
SMILESCOC(=O)CC(O)C(O)c1ncc([N+](=O)[O-])[nH]1
InChIInChI=1S/C8H11N3O6/c1-17-6(13)2-4(12)7(14)8-9-3-5(10-8)11(15)16/h3-4,7,12,14H,2H2,1H3,(H,9,10)
InChIKeyPJRALQRXPRBTIZ-UHFFFAOYSA-N
XLogP-0.72
TPSA138.58 Ų
H-Bond Donors3
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.19
LogP ≤ 5-0.72
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate?
The IUPAC name of methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate (CID 171895403) is methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate.
What is the SMILES notation for methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate?
The canonical SMILES for methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate is COC(=O)CC(O)C(O)c1ncc([N+](=O)[O-])[nH]1.
What is the InChIKey of methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate?
The InChIKey is PJRALQRXPRBTIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O6/c1-17-6(13)2-4(12)7(14)8-9-3-5(10-8)11(15)16/h3-4,7,12,14H,2H2,1H3,(H,9,10).
What are the key properties of methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate?
methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate has a molecular weight of 245.19 g/mol, XLogP of -0.72, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,4-dihydroxy-4-(5-nitro-1H-imidazol-2-yl)butanoate is sourced from PubChem (CID 171895403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).