C10H12N2O6 — CID 171895577
methyl 3,4-dihydroxy-4-(2-nitro-3-pyridinyl)butanoate (PubChem CID 171895577) has the molecular formula C10H12N2O6 and a molecular weight of 256.21 g/mol. Its IUPAC name is methyl 3,4-dihydroxy-4-(2-nitro-3-pyridinyl)butanoate.
| Compound Name | methyl 3,4-dihydroxy-4-(2-nitro-3-pyridinyl)butanoate |
|---|---|
| PubChem CID | 171895577 |
| Molecular Formula | C10H12N2O6 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | methyl 3,4-dihydroxy-4-(2-nitro-3-pyridinyl)butanoate |
| SMILES | COC(=O)CC(O)C(O)c1cccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12N2O6/c1-18-8(14)5-7(13)9(15)6-3-2-4-11-10(6)12(16)17/h2-4,7,9,13,15H,5H2,1H3 |
| InChIKey | VIFGXLUTDINIJR-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|