About methyl (2-nitro-3-pyridinyl) carbonate
methyl (2-nitro-3-pyridinyl) carbonate (PubChem CID 45116378) has the molecular formula C7H6N2O5
and a molecular weight of 198.13 g/mol. Its IUPAC name is methyl (2-nitro-3-pyridinyl) carbonate.
Molecular Properties
| Compound Name | methyl (2-nitro-3-pyridinyl) carbonate |
| PubChem CID | 45116378 |
| Molecular Formula | C7H6N2O5 |
| Molecular Weight | 198.13 g/mol |
| Exact Mass | 198.03 |
| IUPAC Name | methyl (2-nitro-3-pyridinyl) carbonate |
| SMILES | COC(=O)Oc1cccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6N2O5/c1-13-7(10)14-5-3-2-4-8-6(5)9(11)12/h2-4H,1H3 |
| InChIKey | PPTYTAHMWXEWNY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.13 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (2-nitro-3-pyridinyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2-nitro-3-pyridinyl) carbonate?
The IUPAC name of methyl (2-nitro-3-pyridinyl) carbonate (CID 45116378) is methyl (2-nitro-3-pyridinyl) carbonate.
What is the SMILES notation for methyl (2-nitro-3-pyridinyl) carbonate?
The canonical SMILES for methyl (2-nitro-3-pyridinyl) carbonate is COC(=O)Oc1cccnc1[N+](=O)[O-].
What is the InChIKey of methyl (2-nitro-3-pyridinyl) carbonate?
The InChIKey is PPTYTAHMWXEWNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O5/c1-13-7(10)14-5-3-2-4-8-6(5)9(11)12/h2-4H,1H3.
What are the key properties of methyl (2-nitro-3-pyridinyl) carbonate?
methyl (2-nitro-3-pyridinyl) carbonate has a molecular weight of 198.13 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2-nitro-3-pyridinyl) carbonate is sourced from PubChem (CID 45116378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).