About (2-nitro-3-pyridinyl) N-methylcarbamate
(2-nitro-3-pyridinyl) N-methylcarbamate (PubChem CID 45116340) has the molecular formula C7H7N3O4
and a molecular weight of 197.15 g/mol. Its IUPAC name is (2-nitro-3-pyridinyl) N-methylcarbamate.
Molecular Properties
| Compound Name | (2-nitro-3-pyridinyl) N-methylcarbamate |
| PubChem CID | 45116340 |
| Molecular Formula | C7H7N3O4 |
| Molecular Weight | 197.15 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | (2-nitro-3-pyridinyl) N-methylcarbamate |
| SMILES | CNC(=O)Oc1cccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7N3O4/c1-8-7(11)14-5-3-2-4-9-6(5)10(12)13/h2-4H,1H3,(H,8,11) |
| InChIKey | ICLNNCGQGBDWIP-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.15 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-nitro-3-pyridinyl) N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitro-3-pyridinyl) N-methylcarbamate?
The IUPAC name of (2-nitro-3-pyridinyl) N-methylcarbamate (CID 45116340) is (2-nitro-3-pyridinyl) N-methylcarbamate.
What is the SMILES notation for (2-nitro-3-pyridinyl) N-methylcarbamate?
The canonical SMILES for (2-nitro-3-pyridinyl) N-methylcarbamate is CNC(=O)Oc1cccnc1[N+](=O)[O-].
What is the InChIKey of (2-nitro-3-pyridinyl) N-methylcarbamate?
The InChIKey is ICLNNCGQGBDWIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O4/c1-8-7(11)14-5-3-2-4-9-6(5)10(12)13/h2-4H,1H3,(H,8,11).
What are the key properties of (2-nitro-3-pyridinyl) N-methylcarbamate?
(2-nitro-3-pyridinyl) N-methylcarbamate has a molecular weight of 197.15 g/mol, XLogP of 0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitro-3-pyridinyl) N-methylcarbamate is sourced from PubChem (CID 45116340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).