C9H11N3O5 — CID 43509914
N-(2-hydroxyethyl)-2-[(2-nitro-3-pyridinyl)oxy]acetamide (PubChem CID 43509914) has the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[(2-nitro-3-pyridinyl)oxy]acetamide.
| Compound Name | N-(2-hydroxyethyl)-2-[(2-nitro-3-pyridinyl)oxy]acetamide |
|---|---|
| PubChem CID | 43509914 |
| Molecular Formula | C9H11N3O5 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[(2-nitro-3-pyridinyl)oxy]acetamide |
| SMILES | O=C(COc1cccnc1[N+](=O)[O-])NCCO |
| InChI | InChI=1S/C9H11N3O5/c13-5-4-10-8(14)6-17-7-2-1-3-11-9(7)12(15)16/h1-3,13H,4-6H2,(H,10,14) |
| InChIKey | VOPVPONKDMJCBD-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|