C19H23N3O4 — CID 40575021
N-[2,6-di(propan-2-yl)phenyl]-2-[(2-nitro-3-pyridinyl)oxy]acetamide (PubChem CID 40575021) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2-[(2-nitro-3-pyridinyl)oxy]acetamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2-[(2-nitro-3-pyridinyl)oxy]acetamide |
|---|---|
| PubChem CID | 40575021 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2-[(2-nitro-3-pyridinyl)oxy]acetamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)COc1cccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H23N3O4/c1-12(2)14-7-5-8-15(13(3)4)18(14)21-17(23)11-26-16-9-6-10-20-19(16)22(24)25/h5-10,12-13H,11H2,1-4H3,(H,21,23) |
| InChIKey | AKFTZJRRADIPFF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|