C21H26N2O4 — CID 1406605
N-[2,6-di(propan-2-yl)phenyl]-2-(2-methyl-4-nitrophenoxy)acetamide (PubChem CID 1406605) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2-(2-methyl-4-nitrophenoxy)acetamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2-(2-methyl-4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 1406605 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2-(2-methyl-4-nitrophenoxy)acetamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1OCC(=O)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C21H26N2O4/c1-13(2)17-7-6-8-18(14(3)4)21(17)22-20(24)12-27-19-10-9-16(23(25)26)11-15(19)5/h6-11,13-14H,12H2,1-5H3,(H,22,24) |
| InChIKey | BETWLVXHGARTLL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|