C19H21BrN2O4 — CID 3280750
2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)-N-(2-methyl-5-nitrophenyl)acetamide (PubChem CID 3280750) has the molecular formula C19H21BrN2O4 and a molecular weight of 421.29 g/mol. Its IUPAC name is 2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)-N-(2-methyl-5-nitrophenyl)acetamide.
| Compound Name | 2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)-N-(2-methyl-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3280750 |
| Molecular Formula | C19H21BrN2O4 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 2-(4-bromo-5-methyl-2-propan-2-ylphenoxy)-N-(2-methyl-5-nitrophenyl)acetamide |
| SMILES | Cc1cc(OCC(=O)Nc2cc([N+](=O)[O-])ccc2C)c(C(C)C)cc1Br |
| InChI | InChI=1S/C19H21BrN2O4/c1-11(2)15-9-16(20)13(4)7-18(15)26-10-19(23)21-17-8-14(22(24)25)6-5-12(17)3/h5-9,11H,10H2,1-4H3,(H,21,23) |
| InChIKey | CGZGJITWSPFSPU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|