C16H14N2O6 — CID 53264010
3-[[2-(2-methyl-4-nitrophenoxy)acetyl]amino]benzoic acid (PubChem CID 53264010) has the molecular formula C16H14N2O6 and a molecular weight of 330.30 g/mol. Its IUPAC name is 3-[[2-(2-methyl-4-nitrophenoxy)acetyl]amino]benzoic acid.
| Compound Name | 3-[[2-(2-methyl-4-nitrophenoxy)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 53264010 |
| Molecular Formula | C16H14N2O6 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-[[2-(2-methyl-4-nitrophenoxy)acetyl]amino]benzoic acid |
| SMILES | Cc1cc([N+](=O)[O-])ccc1OCC(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C16H14N2O6/c1-10-7-13(18(22)23)5-6-14(10)24-9-15(19)17-12-4-2-3-11(8-12)16(20)21/h2-8H,9H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | JUYRYXJNUHIEKD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|