C10H11N3O4 — CID 3578333
N-cyclopropyl-2-[(2-nitro-3-pyridinyl)oxy]acetamide (PubChem CID 3578333) has the molecular formula C10H11N3O4 and a molecular weight of 237.21 g/mol. Its IUPAC name is N-cyclopropyl-2-[(2-nitro-3-pyridinyl)oxy]acetamide.
| Compound Name | N-cyclopropyl-2-[(2-nitro-3-pyridinyl)oxy]acetamide |
|---|---|
| PubChem CID | 3578333 |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | N-cyclopropyl-2-[(2-nitro-3-pyridinyl)oxy]acetamide |
| SMILES | O=C(COc1cccnc1[N+](=O)[O-])NC1CC1 |
| InChI | InChI=1S/C10H11N3O4/c14-9(12-7-3-4-7)6-17-8-2-1-5-11-10(8)13(15)16/h1-2,5,7H,3-4,6H2,(H,12,14) |
| InChIKey | XJSPSCRYWASILH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|