About benzo[h]quinolin-10-yl N-methylcarbamate
benzo[h]quinolin-10-yl N-methylcarbamate (PubChem CID 139035586) has the molecular formula C15H12N2O2
and a molecular weight of 252.27 g/mol. Its IUPAC name is benzo[h]quinolin-10-yl N-methylcarbamate.
Molecular Properties
| Compound Name | benzo[h]quinolin-10-yl N-methylcarbamate |
| PubChem CID | 139035586 |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | benzo[h]quinolin-10-yl N-methylcarbamate |
| SMILES | CNC(=O)Oc1cccc2ccc3cccnc3c12 |
| InChI | InChI=1S/C15H12N2O2/c1-16-15(18)19-12-6-2-4-10-7-8-11-5-3-9-17-14(11)13(10)12/h2-9H,1H3,(H,16,18) |
| InChIKey | SPSFOKBUNCZELD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[h]quinolin-10-yl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[h]quinolin-10-yl N-methylcarbamate?
The IUPAC name of benzo[h]quinolin-10-yl N-methylcarbamate (CID 139035586) is benzo[h]quinolin-10-yl N-methylcarbamate.
What is the SMILES notation for benzo[h]quinolin-10-yl N-methylcarbamate?
The canonical SMILES for benzo[h]quinolin-10-yl N-methylcarbamate is CNC(=O)Oc1cccc2ccc3cccnc3c12.
What is the InChIKey of benzo[h]quinolin-10-yl N-methylcarbamate?
The InChIKey is SPSFOKBUNCZELD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O2/c1-16-15(18)19-12-6-2-4-10-7-8-11-5-3-9-17-14(11)13(10)12/h2-9H,1H3,(H,16,18).
What are the key properties of benzo[h]quinolin-10-yl N-methylcarbamate?
benzo[h]quinolin-10-yl N-methylcarbamate has a molecular weight of 252.27 g/mol, XLogP of 3.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[h]quinolin-10-yl N-methylcarbamate is sourced from PubChem (CID 139035586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).