C16H10Cl2N2O2 — CID 3623243
quinolin-8-yl N-(3,4-dichlorophenyl)carbamate (PubChem CID 3623243) has the molecular formula C16H10Cl2N2O2 and a molecular weight of 333.17 g/mol. Its IUPAC name is quinolin-8-yl N-(3,4-dichlorophenyl)carbamate.
| Compound Name | quinolin-8-yl N-(3,4-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 3623243 |
| Molecular Formula | C16H10Cl2N2O2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | quinolin-8-yl N-(3,4-dichlorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Oc1cccc2cccnc12 |
| InChI | InChI=1S/C16H10Cl2N2O2/c17-12-7-6-11(9-13(12)18)20-16(21)22-14-5-1-3-10-4-2-8-19-15(10)14/h1-9H,(H,20,21) |
| InChIKey | OPQKNBYTDQCNCX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |