About quinolin-8-yl N-(4-pentoxyphenyl)carbamate
quinolin-8-yl N-(4-pentoxyphenyl)carbamate (PubChem CID 69031420) has the molecular formula C21H22N2O3
and a molecular weight of 350.42 g/mol. Its IUPAC name is quinolin-8-yl N-(4-pentoxyphenyl)carbamate.
Molecular Properties
| Compound Name | quinolin-8-yl N-(4-pentoxyphenyl)carbamate |
| PubChem CID | 69031420 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | quinolin-8-yl N-(4-pentoxyphenyl)carbamate |
| SMILES | CCCCCOc1ccc(NC(=O)Oc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C21H22N2O3/c1-2-3-4-15-25-18-12-10-17(11-13-18)23-21(24)26-19-9-5-7-16-8-6-14-22-20(16)19/h5-14H,2-4,15H2,1H3,(H,23,24) |
| InChIKey | BMRKBZNJBKGZGG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze quinolin-8-yl N-(4-pentoxyphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-8-yl N-(4-pentoxyphenyl)carbamate?
The IUPAC name of quinolin-8-yl N-(4-pentoxyphenyl)carbamate (CID 69031420) is quinolin-8-yl N-(4-pentoxyphenyl)carbamate.
What is the SMILES notation for quinolin-8-yl N-(4-pentoxyphenyl)carbamate?
The canonical SMILES for quinolin-8-yl N-(4-pentoxyphenyl)carbamate is CCCCCOc1ccc(NC(=O)Oc2cccc3cccnc23)cc1.
What is the InChIKey of quinolin-8-yl N-(4-pentoxyphenyl)carbamate?
The InChIKey is BMRKBZNJBKGZGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O3/c1-2-3-4-15-25-18-12-10-17(11-13-18)23-21(24)26-19-9-5-7-16-8-6-14-22-20(16)19/h5-14H,2-4,15H2,1H3,(H,23,24).
What are the key properties of quinolin-8-yl N-(4-pentoxyphenyl)carbamate?
quinolin-8-yl N-(4-pentoxyphenyl)carbamate has a molecular weight of 350.42 g/mol, XLogP of 5.41, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-8-yl N-(4-pentoxyphenyl)carbamate is sourced from PubChem (CID 69031420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).