About quinolin-8-yl 2-ethylhexanoate
quinolin-8-yl 2-ethylhexanoate (PubChem CID 163430049) has the molecular formula C17H21NO2
and a molecular weight of 271.36 g/mol. Its IUPAC name is quinolin-8-yl 2-ethylhexanoate.
Molecular Properties
| Compound Name | quinolin-8-yl 2-ethylhexanoate |
| PubChem CID | 163430049 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | quinolin-8-yl 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)Oc1cccc2cccnc12 |
| InChI | InChI=1S/C17H21NO2/c1-3-5-8-13(4-2)17(19)20-15-11-6-9-14-10-7-12-18-16(14)15/h6-7,9-13H,3-5,8H2,1-2H3 |
| InChIKey | APSANWDQFMVGAE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze quinolin-8-yl 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-8-yl 2-ethylhexanoate?
The IUPAC name of quinolin-8-yl 2-ethylhexanoate (CID 163430049) is quinolin-8-yl 2-ethylhexanoate.
What is the SMILES notation for quinolin-8-yl 2-ethylhexanoate?
The canonical SMILES for quinolin-8-yl 2-ethylhexanoate is CCCCC(CC)C(=O)Oc1cccc2cccnc12.
What is the InChIKey of quinolin-8-yl 2-ethylhexanoate?
The InChIKey is APSANWDQFMVGAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO2/c1-3-5-8-13(4-2)17(19)20-15-11-6-9-14-10-7-12-18-16(14)15/h6-7,9-13H,3-5,8H2,1-2H3.
What are the key properties of quinolin-8-yl 2-ethylhexanoate?
quinolin-8-yl 2-ethylhexanoate has a molecular weight of 271.36 g/mol, XLogP of 4.36, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-8-yl 2-ethylhexanoate is sourced from PubChem (CID 163430049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).