C26H36N2O6 — CID 122381911
4-[(4-butoxyphenyl)carbamoyloxy]butyl N-(4-butoxyphenyl)carbamate (PubChem CID 122381911) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is 4-[(4-butoxyphenyl)carbamoyloxy]butyl N-(4-butoxyphenyl)carbamate.
| Compound Name | 4-[(4-butoxyphenyl)carbamoyloxy]butyl N-(4-butoxyphenyl)carbamate |
|---|---|
| PubChem CID | 122381911 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 4-[(4-butoxyphenyl)carbamoyloxy]butyl N-(4-butoxyphenyl)carbamate |
| SMILES | CCCCOc1ccc(NC(=O)OCCCCOC(=O)Nc2ccc(OCCCC)cc2)cc1 |
| InChI | InChI=1S/C26H36N2O6/c1-3-5-17-31-23-13-9-21(10-14-23)27-25(29)33-19-7-8-20-34-26(30)28-22-11-15-24(16-12-22)32-18-6-4-2/h9-16H,3-8,17-20H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | QOSPCYHCEHXPHB-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|