C33H35NO9 — CID 118216431
[4-[4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoyl]oxyphenyl] 4-(butoxycarbonylamino)benzoate (PubChem CID 118216431) has the molecular formula C33H35NO9 and a molecular weight of 589.64 g/mol. Its IUPAC name is [4-[4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoyl]oxyphenyl] 4-(butoxycarbonylamino)benzoate.
| Compound Name | [4-[4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoyl]oxyphenyl] 4-(butoxycarbonylamino)benzoate |
|---|---|
| PubChem CID | 118216431 |
| Molecular Formula | C33H35NO9 |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | [4-[4-[4-(2-methylprop-2-enoyloxy)butoxy]benzoyl]oxyphenyl] 4-(butoxycarbonylamino)benzoate |
| SMILES | C=C(C)C(=O)OCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(NC(=O)OCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H35NO9/c1-4-5-20-41-33(38)34-26-12-8-24(9-13-26)31(36)42-28-16-18-29(19-17-28)43-32(37)25-10-14-27(15-11-25)39-21-6-7-22-40-30(35)23(2)3/h8-19H,2,4-7,20-22H2,1,3H3,(H,34,38) |
| InChIKey | FXNCWIAERQVBJB-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|