C29H27NO9 — CID 118216346
[4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl] 4-(ethoxycarbonylamino)benzoate (PubChem CID 118216346) has the molecular formula C29H27NO9 and a molecular weight of 533.53 g/mol. Its IUPAC name is [4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl] 4-(ethoxycarbonylamino)benzoate.
| Compound Name | [4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl] 4-(ethoxycarbonylamino)benzoate |
|---|---|
| PubChem CID | 118216346 |
| Molecular Formula | C29H27NO9 |
| Molecular Weight | 533.53 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | [4-[4-(3-prop-2-enoyloxypropoxy)benzoyl]oxyphenyl] 4-(ethoxycarbonylamino)benzoate |
| SMILES | C=CC(=O)OCCCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(NC(=O)OCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H27NO9/c1-3-26(31)37-19-5-18-36-23-12-8-21(9-13-23)28(33)39-25-16-14-24(15-17-25)38-27(32)20-6-10-22(11-7-20)30-29(34)35-4-2/h3,6-17H,1,4-5,18-19H2,2H3,(H,30,34) |
| InChIKey | SCYDXDNVMXCCNY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|