C20H17NO5 — CID 59768911
(4-cyanophenyl) 4-(3-prop-2-enoyloxypropoxy)benzoate (PubChem CID 59768911) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is (4-cyanophenyl) 4-(3-prop-2-enoyloxypropoxy)benzoate.
| Compound Name | (4-cyanophenyl) 4-(3-prop-2-enoyloxypropoxy)benzoate |
|---|---|
| PubChem CID | 59768911 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (4-cyanophenyl) 4-(3-prop-2-enoyloxypropoxy)benzoate |
| SMILES | C=CC(=O)OCCCOc1ccc(C(=O)Oc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C20H17NO5/c1-2-19(22)25-13-3-12-24-17-10-6-16(7-11-17)20(23)26-18-8-4-15(14-21)5-9-18/h2,4-11H,1,3,12-13H2 |
| InChIKey | KBNLPFYPXWXYGA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|