C25H25NO6 — CID 102401535
[4-(7-prop-2-enoyloxyheptoxycarbonyl)phenyl] 4-cyanobenzoate (PubChem CID 102401535) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is [4-(7-prop-2-enoyloxyheptoxycarbonyl)phenyl] 4-cyanobenzoate.
| Compound Name | [4-(7-prop-2-enoyloxyheptoxycarbonyl)phenyl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 102401535 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | [4-(7-prop-2-enoyloxyheptoxycarbonyl)phenyl] 4-cyanobenzoate |
| SMILES | C=CC(=O)OCCCCCCCOC(=O)c1ccc(OC(=O)c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C25H25NO6/c1-2-23(27)30-16-6-4-3-5-7-17-31-24(28)20-12-14-22(15-13-20)32-25(29)21-10-8-19(18-26)9-11-21/h2,8-15H,1,3-7,16-17H2 |
| InChIKey | NOJHETDLJZRTJT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|