C35H43NO6Si2 — CID 100958797
[4-(4-cyanophenyl)phenyl] 4-[5-[[dimethyl(3-prop-2-enoyloxypropyl)silyl]oxy-dimethylsilyl]pentoxy]benzoate (PubChem CID 100958797) has the molecular formula C35H43NO6Si2 and a molecular weight of 629.90 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] 4-[5-[[dimethyl(3-prop-2-enoyloxypropyl)silyl]oxy-dimethylsilyl]pentoxy]benzoate.
| Compound Name | [4-(4-cyanophenyl)phenyl] 4-[5-[[dimethyl(3-prop-2-enoyloxypropyl)silyl]oxy-dimethylsilyl]pentoxy]benzoate |
|---|---|
| PubChem CID | 100958797 |
| Molecular Formula | C35H43NO6Si2 |
| Molecular Weight | 629.90 g/mol |
| Exact Mass | 629.26 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] 4-[5-[[dimethyl(3-prop-2-enoyloxypropyl)silyl]oxy-dimethylsilyl]pentoxy]benzoate |
| SMILES | C=CC(=O)OCCC[Si](C)(C)O[Si](C)(C)CCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(C#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H43NO6Si2/c1-6-34(37)40-24-10-26-44(4,5)42-43(2,3)25-9-7-8-23-39-32-19-17-31(18-20-32)35(38)41-33-21-15-30(16-22-33)29-13-11-28(27-36)12-14-29/h6,11-22H,1,7-10,23-26H2,2-5H3 |
| InChIKey | ZBRXQWGSCBRLHV-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.90 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|