C22H19NO7 — CID 58234144
(4-cyanophenyl) 4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoate (PubChem CID 58234144) has the molecular formula C22H19NO7 and a molecular weight of 409.39 g/mol. Its IUPAC name is (4-cyanophenyl) 4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoate.
| Compound Name | (4-cyanophenyl) 4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoate |
|---|---|
| PubChem CID | 58234144 |
| Molecular Formula | C22H19NO7 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | (4-cyanophenyl) 4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoate |
| SMILES | C=CC(=O)OCCCCOC(=O)Oc1ccc(C(=O)Oc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C22H19NO7/c1-2-20(24)27-13-3-4-14-28-22(26)30-19-11-7-17(8-12-19)21(25)29-18-9-5-16(15-23)6-10-18/h2,5-12H,1,3-4,13-14H2 |
| InChIKey | FMHTVHSXPPIBPE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 111.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|