C44H34N2O10 — CID 162222921
[4-(4-cyanophenyl)phenyl] 4-(2-prop-2-enoyloxyethoxy)benzoate;(4-cyanophenyl) 4-(2-prop-2-enoyloxyethoxy)benzoate (PubChem CID 162222921) has the molecular formula C44H34N2O10 and a molecular weight of 750.76 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] 4-(2-prop-2-enoyloxyethoxy)benzoate;(4-cyanophenyl) 4-(2-prop-2-enoyloxyethoxy)benzoate.
| Compound Name | [4-(4-cyanophenyl)phenyl] 4-(2-prop-2-enoyloxyethoxy)benzoate;(4-cyanophenyl) 4-(2-prop-2-enoyloxyethoxy)benzoate |
|---|---|
| PubChem CID | 162222921 |
| Molecular Formula | C44H34N2O10 |
| Molecular Weight | 750.76 g/mol |
| Exact Mass | 750.22 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] 4-(2-prop-2-enoyloxyethoxy)benzoate;(4-cyanophenyl) 4-(2-prop-2-enoyloxyethoxy)benzoate |
| SMILES | C=CC(=O)OCCOc1ccc(C(=O)Oc2ccc(-c3ccc(C#N)cc3)cc2)cc1.C=CC(=O)OCCOc1ccc(C(=O)Oc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C25H19NO5.C19H15NO5/c1-2-24(27)30-16-15-29-22-11-9-21(10-12-22)25(28)31-23-13-7-20(8-14-23)19-5-3-18(17-26)4-6-19;1-2-18(21)24-12-11-23-16-9-5-15(6-10-16)19(22)25-17-7-3-14(13-20)4-8-17/h2-14H,1,15-16H2;2-10H,1,11-12H2 |
| InChIKey | ZUJGBWFCCHRWST-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 171.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.76 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|