C24H27NO3 — CID 67732032
8-[4-(4-cyanophenyl)phenoxy]octyl prop-2-enoate (PubChem CID 67732032) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 8-[4-(4-cyanophenyl)phenoxy]octyl prop-2-enoate.
| Compound Name | 8-[4-(4-cyanophenyl)phenoxy]octyl prop-2-enoate |
|---|---|
| PubChem CID | 67732032 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 8-[4-(4-cyanophenyl)phenoxy]octyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCCOc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C24H27NO3/c1-2-24(26)28-18-8-6-4-3-5-7-17-27-23-15-13-22(14-16-23)21-11-9-20(19-25)10-12-21/h2,9-16H,1,3-8,17-18H2 |
| InChIKey | HVROGMFAKGEKPI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|