C28H26FNO3 — CID 122665030
6-[4-[4-(4-cyanophenyl)-2-fluorophenyl]phenoxy]hexyl prop-2-enoate (PubChem CID 122665030) has the molecular formula C28H26FNO3 and a molecular weight of 443.52 g/mol. Its IUPAC name is 6-[4-[4-(4-cyanophenyl)-2-fluorophenyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[4-(4-cyanophenyl)-2-fluorophenyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 122665030 |
| Molecular Formula | C28H26FNO3 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 6-[4-[4-(4-cyanophenyl)-2-fluorophenyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(-c2ccc(-c3ccc(C#N)cc3)cc2F)cc1 |
| InChI | InChI=1S/C28H26FNO3/c1-2-28(31)33-18-6-4-3-5-17-32-25-14-11-23(12-15-25)26-16-13-24(19-27(26)29)22-9-7-21(20-30)8-10-22/h2,7-16,19H,1,3-6,17-18H2 |
| InChIKey | TVKAPWOHPPMGTF-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|