C37H44O6 — CID 59459924
6-[4-[3-methyl-4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl]phenoxy]hexyl prop-2-enoate (PubChem CID 59459924) has the molecular formula C37H44O6 and a molecular weight of 584.75 g/mol. Its IUPAC name is 6-[4-[3-methyl-4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[3-methyl-4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 59459924 |
| Molecular Formula | C37H44O6 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | 6-[4-[3-methyl-4-[4-(6-prop-2-enoyloxyhexoxy)phenyl]phenyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(-c2ccc(-c3ccc(OCCCCCCOC(=O)C=C)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C37H44O6/c1-4-36(38)42-26-12-8-6-10-24-40-33-19-14-30(15-20-33)32-18-23-35(29(3)28-32)31-16-21-34(22-17-31)41-25-11-7-9-13-27-43-37(39)5-2/h4-5,14-23,28H,1-2,6-13,24-27H2,3H3 |
| InChIKey | RPUKNRKXVHCMOT-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|