C35H46O5 — CID 142377297
6-[4-[4-[4-(6-methoxyhexoxy)phenyl]-3-methylphenyl]cyclohexa-2,4-dien-1-yl]oxyhexyl prop-2-enoate (PubChem CID 142377297) has the molecular formula C35H46O5 and a molecular weight of 546.75 g/mol. Its IUPAC name is 6-[4-[4-[4-(6-methoxyhexoxy)phenyl]-3-methylphenyl]cyclohexa-2,4-dien-1-yl]oxyhexyl prop-2-enoate.
| Compound Name | 6-[4-[4-[4-(6-methoxyhexoxy)phenyl]-3-methylphenyl]cyclohexa-2,4-dien-1-yl]oxyhexyl prop-2-enoate |
|---|---|
| PubChem CID | 142377297 |
| Molecular Formula | C35H46O5 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | 6-[4-[4-[4-(6-methoxyhexoxy)phenyl]-3-methylphenyl]cyclohexa-2,4-dien-1-yl]oxyhexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOC1C=CC(c2ccc(-c3ccc(OCCCCCCOC)cc3)c(C)c2)=CC1 |
| InChI | InChI=1S/C35H46O5/c1-4-35(36)40-26-12-8-7-11-25-38-32-18-13-29(14-19-32)31-17-22-34(28(2)27-31)30-15-20-33(21-16-30)39-24-10-6-5-9-23-37-3/h4,13-18,20-22,27,32H,1,5-12,19,23-26H2,2-3H3 |
| InChIKey | TWPLBRBXQWTLOS-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|