C55H68O15 — CID 159432592
4-O-[3-formyl-4-[4-(4-methylphenoxy)carbonylcyclohexanecarbonyl]oxyphenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate;6-methoxyhexyl prop-2-enoate (PubChem CID 159432592) has the molecular formula C55H68O15 and a molecular weight of 969.13 g/mol. Its IUPAC name is 4-O-[3-formyl-4-[4-(4-methylphenoxy)carbonylcyclohexanecarbonyl]oxyphenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate;6-methoxyhexyl prop-2-enoate.
| Compound Name | 4-O-[3-formyl-4-[4-(4-methylphenoxy)carbonylcyclohexanecarbonyl]oxyphenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate;6-methoxyhexyl prop-2-enoate |
|---|---|
| PubChem CID | 159432592 |
| Molecular Formula | C55H68O15 |
| Molecular Weight | 969.13 g/mol |
| Exact Mass | 968.46 |
| IUPAC Name | 4-O-[3-formyl-4-[4-(4-methylphenoxy)carbonylcyclohexanecarbonyl]oxyphenyl] 1-O-[4-(6-prop-2-enoyloxyhexoxy)phenyl] cyclohexane-1,4-dicarboxylate;6-methoxyhexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOC.C=CC(=O)OCCCCCCOc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(OC(=O)C4CCC(C(=O)Oc5ccc(C)cc5)CC4)c(C=O)c3)CC2)cc1 |
| InChI | InChI=1S/C45H50O12.C10H18O3/c1-3-41(47)53-27-7-5-4-6-26-52-36-20-22-38(23-21-36)55-43(49)31-10-12-33(13-11-31)44(50)56-39-24-25-40(35(28-39)29-46)57-45(51)34-16-14-32(15-17-34)42(48)54-37-18-8-30(2)9-19-37;1-3-10(11)13-9-7-5-4-6-8-12-2/h3,8-9,18-25,28-29,31-34H,1,4-7,10-17,26-27H2,2H3;3H,1,4-9H2,2H3 |
| InChIKey | LRECTKIIMBPYFR-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 193.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.13 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|