C51H68O16 — CID 167339398
4-O-[4-[3-methyl-4-[4-[4-(4-prop-2-enoyloxybutoxycarbonyl)cyclohexanecarbonyl]oxycyclohexanecarbonyl]oxyphenoxy]carbonylcyclohexyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate (PubChem CID 167339398) has the molecular formula C51H68O16 and a molecular weight of 937.09 g/mol. Its IUPAC name is 4-O-[4-[3-methyl-4-[4-[4-(4-prop-2-enoyloxybutoxycarbonyl)cyclohexanecarbonyl]oxycyclohexanecarbonyl]oxyphenoxy]carbonylcyclohexyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[4-[3-methyl-4-[4-[4-(4-prop-2-enoyloxybutoxycarbonyl)cyclohexanecarbonyl]oxycyclohexanecarbonyl]oxyphenoxy]carbonylcyclohexyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 167339398 |
| Molecular Formula | C51H68O16 |
| Molecular Weight | 937.09 g/mol |
| Exact Mass | 936.45 |
| IUPAC Name | 4-O-[4-[3-methyl-4-[4-[4-(4-prop-2-enoyloxybutoxycarbonyl)cyclohexanecarbonyl]oxycyclohexanecarbonyl]oxyphenoxy]carbonylcyclohexyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCCCOC(=O)C1CCC(C(=O)OC2CCC(C(=O)Oc3ccc(OC(=O)C4CCC(OC(=O)C5CCC(C(=O)OCCCCOC(=O)C=C)CC5)CC4)c(C)c3)CC2)CC1 |
| InChI | InChI=1S/C51H68O16/c1-4-44(52)60-28-6-8-30-62-46(54)34-10-14-36(15-11-34)48(56)64-40-22-18-38(19-23-40)50(58)66-42-26-27-43(33(3)32-42)67-51(59)39-20-24-41(25-21-39)65-49(57)37-16-12-35(13-17-37)47(55)63-31-9-7-29-61-45(53)5-2/h4-5,26-27,32,34-41H,1-2,6-25,28-31H2,3H3 |
| InChIKey | ASGPEYPOERIVPB-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 210.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.09 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|