C38H50N2O14 — CID 134352399
4-O-[3-[(Z)-C-hydroperoxy-N-(methylamino)carbonimidoyl]-4-[4-(4-prop-2-enoyloxybutoxycarbonyl)cyclohexanecarbonyl]oxyphenyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate (PubChem CID 134352399) has the molecular formula C38H50N2O14 and a molecular weight of 758.82 g/mol. Its IUPAC name is 4-O-[3-[(Z)-C-hydroperoxy-N-(methylamino)carbonimidoyl]-4-[4-(4-prop-2-enoyloxybutoxycarbonyl)cyclohexanecarbonyl]oxyphenyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[3-[(Z)-C-hydroperoxy-N-(methylamino)carbonimidoyl]-4-[4-(4-prop-2-enoyloxybutoxycarbonyl)cyclohexanecarbonyl]oxyphenyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 134352399 |
| Molecular Formula | C38H50N2O14 |
| Molecular Weight | 758.82 g/mol |
| Exact Mass | 758.33 |
| IUPAC Name | 4-O-[3-[(Z)-C-hydroperoxy-N-(methylamino)carbonimidoyl]-4-[4-(4-prop-2-enoyloxybutoxycarbonyl)cyclohexanecarbonyl]oxyphenyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCCCOC(=O)C1CCC(C(=O)Oc2ccc(OC(=O)C3CCC(C(=O)OCCCCOC(=O)C=C)CC3)c(/C(=N/NC)OO)c2)CC1 |
| InChI | InChI=1S/C38H50N2O14/c1-4-32(41)48-20-6-8-22-50-35(43)25-10-14-27(15-11-25)37(45)52-29-18-19-31(30(24-29)34(54-47)40-39-3)53-38(46)28-16-12-26(13-17-28)36(44)51-23-9-7-21-49-33(42)5-2/h4-5,18-19,24-28,39,47H,1-2,6-17,20-23H2,3H3/b40-34- |
| InChIKey | XZLZHXXNWINECC-UQQUJRAVSA-N |
| XLogP | 4.59 |
| TPSA | 211.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.82 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|