C40H56N2O12 — CID 172949273
methane;4-O-[3-[(E)-C-methyl-N-(methylamino)carbonimidoyl]-4-[4-(4-prop-2-enoyloxybutoxycarbonyl)cyclohexanecarbonyl]oxyphenyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate (PubChem CID 172949273) has the molecular formula C40H56N2O12 and a molecular weight of 756.89 g/mol. Its IUPAC name is methane;4-O-[3-[(E)-C-methyl-N-(methylamino)carbonimidoyl]-4-[4-(4-prop-2-enoyloxybutoxycarbonyl)cyclohexanecarbonyl]oxyphenyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | methane;4-O-[3-[(E)-C-methyl-N-(methylamino)carbonimidoyl]-4-[4-(4-prop-2-enoyloxybutoxycarbonyl)cyclohexanecarbonyl]oxyphenyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 172949273 |
| Molecular Formula | C40H56N2O12 |
| Molecular Weight | 756.89 g/mol |
| Exact Mass | 756.38 |
| IUPAC Name | methane;4-O-[3-[(E)-C-methyl-N-(methylamino)carbonimidoyl]-4-[4-(4-prop-2-enoyloxybutoxycarbonyl)cyclohexanecarbonyl]oxyphenyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate |
| SMILES | C.C=CC(=O)OCCCCOC(=O)C1CCC(C(=O)Oc2ccc(OC(=O)C3CCC(C(=O)OCCCCOC(=O)C=C)CC3)c(/C(C)=N/NC)c2)CC1 |
| InChI | InChI=1S/C39H52N2O12.CH4/c1-5-34(42)48-21-7-9-23-50-36(44)27-11-15-29(16-12-27)38(46)52-31-19-20-33(32(25-31)26(3)41-40-4)53-39(47)30-17-13-28(14-18-30)37(45)51-24-10-8-22-49-35(43)6-2;/h5-6,19-20,25,27-30,40H,1-2,7-18,21-24H2,3-4H3;1H4/b41-26+; |
| InChIKey | CQNYYQZUNBVGLR-IVXXXOJESA-N |
| XLogP | 5.79 |
| TPSA | 182.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.89 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|