C26H38N2O6 — CID 172989154
methane;4-O-[4-methyl-2-[(E)-C-methyl-N-(methylamino)carbonimidoyl]phenyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate (PubChem CID 172989154) has the molecular formula C26H38N2O6 and a molecular weight of 474.60 g/mol. Its IUPAC name is methane;4-O-[4-methyl-2-[(E)-C-methyl-N-(methylamino)carbonimidoyl]phenyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | methane;4-O-[4-methyl-2-[(E)-C-methyl-N-(methylamino)carbonimidoyl]phenyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 172989154 |
| Molecular Formula | C26H38N2O6 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | methane;4-O-[4-methyl-2-[(E)-C-methyl-N-(methylamino)carbonimidoyl]phenyl] 1-O-(4-prop-2-enoyloxybutyl) cyclohexane-1,4-dicarboxylate |
| SMILES | C.C=CC(=O)OCCCCOC(=O)C1CCC(C(=O)Oc2ccc(C)cc2/C(C)=N/NC)CC1 |
| InChI | InChI=1S/C25H34N2O6.CH4/c1-5-23(28)31-14-6-7-15-32-24(29)19-9-11-20(12-10-19)25(30)33-22-13-8-17(2)16-21(22)18(3)27-26-4;/h5,8,13,16,19-20,26H,1,6-7,9-12,14-15H2,2-4H3;1H4/b27-18+; |
| InChIKey | LSTXALBOIVUHQG-ZEJCXCISSA-N |
| XLogP | 4.34 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|