C36H38Cl2O12 — CID 23529953
bis[2-chloro-4-(4-prop-2-enoyloxybutoxycarbonyl)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 23529953) has the molecular formula C36H38Cl2O12 and a molecular weight of 733.59 g/mol. Its IUPAC name is bis[2-chloro-4-(4-prop-2-enoyloxybutoxycarbonyl)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | bis[2-chloro-4-(4-prop-2-enoyloxybutoxycarbonyl)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 23529953 |
| Molecular Formula | C36H38Cl2O12 |
| Molecular Weight | 733.59 g/mol |
| Exact Mass | 732.17 |
| IUPAC Name | bis[2-chloro-4-(4-prop-2-enoyloxybutoxycarbonyl)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCCCOC(=O)c1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(C(=O)OCCCCOC(=O)C=C)cc3Cl)CC2)c(Cl)c1 |
| InChI | InChI=1S/C36H38Cl2O12/c1-3-31(39)45-17-5-7-19-47-33(41)25-13-15-29(27(37)21-25)49-35(43)23-9-11-24(12-10-23)36(44)50-30-16-14-26(22-28(30)38)34(42)48-20-8-6-18-46-32(40)4-2/h3-4,13-16,21-24H,1-2,5-12,17-20H2 |
| InChIKey | NDNVDNMNNYTLMX-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.59 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|