C31H44O7 — CID 146233877
[2-methoxy-4-(4-prop-2-enoyloxybutoxycarbonyl)phenyl] 4-(4-ethylcyclohexyl)cycloheptane-1-carboxylate (PubChem CID 146233877) has the molecular formula C31H44O7 and a molecular weight of 528.69 g/mol. Its IUPAC name is [2-methoxy-4-(4-prop-2-enoyloxybutoxycarbonyl)phenyl] 4-(4-ethylcyclohexyl)cycloheptane-1-carboxylate.
| Compound Name | [2-methoxy-4-(4-prop-2-enoyloxybutoxycarbonyl)phenyl] 4-(4-ethylcyclohexyl)cycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 146233877 |
| Molecular Formula | C31H44O7 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | [2-methoxy-4-(4-prop-2-enoyloxybutoxycarbonyl)phenyl] 4-(4-ethylcyclohexyl)cycloheptane-1-carboxylate |
| SMILES | C=CC(=O)OCCCCOC(=O)c1ccc(OC(=O)C2CCCC(C3CCC(CC)CC3)CC2)c(OC)c1 |
| InChI | InChI=1S/C31H44O7/c1-4-22-11-13-24(14-12-22)23-9-8-10-25(16-15-23)31(34)38-27-18-17-26(21-28(27)35-3)30(33)37-20-7-6-19-36-29(32)5-2/h5,17-18,21-25H,2,4,6-16,19-20H2,1,3H3 |
| InChIKey | PDZQCEMXKAHHNW-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|