C44H64O8 — CID 122664126
4-prop-2-enoyloxybutyl 2,4-bis[[4-(4-ethylcyclohexyl)cyclohexanecarbonyl]oxy]benzoate (PubChem CID 122664126) has the molecular formula C44H64O8 and a molecular weight of 720.99 g/mol. Its IUPAC name is 4-prop-2-enoyloxybutyl 2,4-bis[[4-(4-ethylcyclohexyl)cyclohexanecarbonyl]oxy]benzoate.
| Compound Name | 4-prop-2-enoyloxybutyl 2,4-bis[[4-(4-ethylcyclohexyl)cyclohexanecarbonyl]oxy]benzoate |
|---|---|
| PubChem CID | 122664126 |
| Molecular Formula | C44H64O8 |
| Molecular Weight | 720.99 g/mol |
| Exact Mass | 720.46 |
| IUPAC Name | 4-prop-2-enoyloxybutyl 2,4-bis[[4-(4-ethylcyclohexyl)cyclohexanecarbonyl]oxy]benzoate |
| SMILES | C=CC(=O)OCCCCOC(=O)c1ccc(OC(=O)C2CCC(C3CCC(CC)CC3)CC2)cc1OC(=O)C1CCC(C2CCC(CC)CC2)CC1 |
| InChI | InChI=1S/C44H64O8/c1-4-30-9-13-32(14-10-30)34-17-21-36(22-18-34)42(46)51-38-25-26-39(44(48)50-28-8-7-27-49-41(45)6-3)40(29-38)52-43(47)37-23-19-35(20-24-37)33-15-11-31(5-2)12-16-33/h6,25-26,29-37H,3-5,7-24,27-28H2,1-2H3 |
| InChIKey | LDCLGCRNHRILPW-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.99 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|