C30H42O6 — CID 118410284
4-prop-2-enoyloxybutyl 4-[4-(4-ethylcyclohexyl)cyclohexanecarbonyl]oxy-3-methylbenzoate (PubChem CID 118410284) has the molecular formula C30H42O6 and a molecular weight of 498.66 g/mol. Its IUPAC name is 4-prop-2-enoyloxybutyl 4-[4-(4-ethylcyclohexyl)cyclohexanecarbonyl]oxy-3-methylbenzoate.
| Compound Name | 4-prop-2-enoyloxybutyl 4-[4-(4-ethylcyclohexyl)cyclohexanecarbonyl]oxy-3-methylbenzoate |
|---|---|
| PubChem CID | 118410284 |
| Molecular Formula | C30H42O6 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | 4-prop-2-enoyloxybutyl 4-[4-(4-ethylcyclohexyl)cyclohexanecarbonyl]oxy-3-methylbenzoate |
| SMILES | C=CC(=O)OCCCCOC(=O)c1ccc(OC(=O)C2CCC(C3CCC(CC)CC3)CC2)c(C)c1 |
| InChI | InChI=1S/C30H42O6/c1-4-22-8-10-23(11-9-22)24-12-14-25(15-13-24)30(33)36-27-17-16-26(20-21(27)3)29(32)35-19-7-6-18-34-28(31)5-2/h5,16-17,20,22-25H,2,4,6-15,18-19H2,1,3H3 |
| InChIKey | FIMPGFPNWPTWDJ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|