C28H38O7 — CID 122664110
2-prop-2-enoyloxyethyl 4-[4-(4-ethylcyclohexyl)cyclohexanecarbonyl]oxy-3-methoxybenzoate (PubChem CID 122664110) has the molecular formula C28H38O7 and a molecular weight of 486.61 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 4-[4-(4-ethylcyclohexyl)cyclohexanecarbonyl]oxy-3-methoxybenzoate.
| Compound Name | 2-prop-2-enoyloxyethyl 4-[4-(4-ethylcyclohexyl)cyclohexanecarbonyl]oxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 122664110 |
| Molecular Formula | C28H38O7 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 4-[4-(4-ethylcyclohexyl)cyclohexanecarbonyl]oxy-3-methoxybenzoate |
| SMILES | C=CC(=O)OCCOC(=O)c1ccc(OC(=O)C2CCC(C3CCC(CC)CC3)CC2)c(OC)c1 |
| InChI | InChI=1S/C28H38O7/c1-4-19-6-8-20(9-7-19)21-10-12-22(13-11-21)28(31)35-24-15-14-23(18-25(24)32-3)27(30)34-17-16-33-26(29)5-2/h5,14-15,18-22H,2,4,6-13,16-17H2,1,3H3 |
| InChIKey | OSAHQYGREZUOQW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|