C47H52O15 — CID 142301433
4-O-[3-methoxy-4-[4-[4-(3-prop-2-enoyloxypropoxy)phenoxy]carbonylcyclohexanecarbonyl]oxyphenyl] 1-O-[4-(3-prop-2-enoyloxypropoxy)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 142301433) has the molecular formula C47H52O15 and a molecular weight of 856.92 g/mol. Its IUPAC name is 4-O-[3-methoxy-4-[4-[4-(3-prop-2-enoyloxypropoxy)phenoxy]carbonylcyclohexanecarbonyl]oxyphenyl] 1-O-[4-(3-prop-2-enoyloxypropoxy)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[3-methoxy-4-[4-[4-(3-prop-2-enoyloxypropoxy)phenoxy]carbonylcyclohexanecarbonyl]oxyphenyl] 1-O-[4-(3-prop-2-enoyloxypropoxy)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 142301433 |
| Molecular Formula | C47H52O15 |
| Molecular Weight | 856.92 g/mol |
| Exact Mass | 856.33 |
| IUPAC Name | 4-O-[3-methoxy-4-[4-[4-(3-prop-2-enoyloxypropoxy)phenoxy]carbonylcyclohexanecarbonyl]oxyphenyl] 1-O-[4-(3-prop-2-enoyloxypropoxy)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCCCOc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(OC(=O)C4CCC(C(=O)Oc5ccc(OCCCOC(=O)C=C)cc5)CC4)c(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C47H52O15/c1-4-42(48)57-28-6-26-55-35-16-20-37(21-17-35)59-44(50)31-8-10-33(11-9-31)46(52)61-39-24-25-40(41(30-39)54-3)62-47(53)34-14-12-32(13-15-34)45(51)60-38-22-18-36(19-23-38)56-27-7-29-58-43(49)5-2/h4-5,16-25,30-34H,1-2,6-15,26-29H2,3H3 |
| InChIKey | OGRDBLMFSLWBCL-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.92 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|