C41H54O12 — CID 59702746
[3-(4-prop-2-enoyloxybutanoyloxy)-4-[4-(4-prop-2-enoyloxybutyl)cyclohexanecarbonyl]oxyphenyl] 4-(4-prop-2-enoyloxybutyl)cyclohexane-1-carboxylate (PubChem CID 59702746) has the molecular formula C41H54O12 and a molecular weight of 738.87 g/mol. Its IUPAC name is [3-(4-prop-2-enoyloxybutanoyloxy)-4-[4-(4-prop-2-enoyloxybutyl)cyclohexanecarbonyl]oxyphenyl] 4-(4-prop-2-enoyloxybutyl)cyclohexane-1-carboxylate.
| Compound Name | [3-(4-prop-2-enoyloxybutanoyloxy)-4-[4-(4-prop-2-enoyloxybutyl)cyclohexanecarbonyl]oxyphenyl] 4-(4-prop-2-enoyloxybutyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59702746 |
| Molecular Formula | C41H54O12 |
| Molecular Weight | 738.87 g/mol |
| Exact Mass | 738.36 |
| IUPAC Name | [3-(4-prop-2-enoyloxybutanoyloxy)-4-[4-(4-prop-2-enoyloxybutyl)cyclohexanecarbonyl]oxyphenyl] 4-(4-prop-2-enoyloxybutyl)cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OCCCCC1CCC(C(=O)Oc2ccc(OC(=O)C3CCC(CCCCOC(=O)C=C)CC3)c(OC(=O)CCCOC(=O)C=C)c2)CC1 |
| InChI | InChI=1S/C41H54O12/c1-4-36(42)48-25-9-7-12-29-15-19-31(20-16-29)40(46)51-33-23-24-34(35(28-33)52-39(45)14-11-27-50-38(44)6-3)53-41(47)32-21-17-30(18-22-32)13-8-10-26-49-37(43)5-2/h4-6,23-24,28-32H,1-3,7-22,25-27H2 |
| InChIKey | RNZFOJJIKOJLRZ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.87 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|