C41H52O7 — CID 163872404
[4-[2-[4-[4-(2-oxobut-3-enyl)cyclohexanecarbonyl]oxyphenyl]ethyl]phenyl] 4-(6-prop-2-enoyloxyhexyl)cyclohexane-1-carboxylate (PubChem CID 163872404) has the molecular formula C41H52O7 and a molecular weight of 656.86 g/mol. Its IUPAC name is [4-[2-[4-[4-(2-oxobut-3-enyl)cyclohexanecarbonyl]oxyphenyl]ethyl]phenyl] 4-(6-prop-2-enoyloxyhexyl)cyclohexane-1-carboxylate.
| Compound Name | [4-[2-[4-[4-(2-oxobut-3-enyl)cyclohexanecarbonyl]oxyphenyl]ethyl]phenyl] 4-(6-prop-2-enoyloxyhexyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 163872404 |
| Molecular Formula | C41H52O7 |
| Molecular Weight | 656.86 g/mol |
| Exact Mass | 656.37 |
| IUPAC Name | [4-[2-[4-[4-(2-oxobut-3-enyl)cyclohexanecarbonyl]oxyphenyl]ethyl]phenyl] 4-(6-prop-2-enoyloxyhexyl)cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)CC1CCC(C(=O)Oc2ccc(CCc3ccc(OC(=O)C4CCC(CCCCCCOC(=O)C=C)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C41H52O7/c1-3-36(42)29-33-14-22-35(23-15-33)41(45)48-38-26-18-32(19-27-38)11-10-31-16-24-37(25-17-31)47-40(44)34-20-12-30(13-21-34)9-7-5-6-8-28-46-39(43)4-2/h3-4,16-19,24-27,30,33-35H,1-2,5-15,20-23,28-29H2 |
| InChIKey | KBDVRSNDZZOYTG-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.86 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|