C31H46O5 — CID 147715552
[4-(4-hexylcyclohexyl)phenyl] 4-(3-prop-2-enoyloxypropoxy)cyclohexane-1-carboxylate (PubChem CID 147715552) has the molecular formula C31H46O5 and a molecular weight of 498.70 g/mol. Its IUPAC name is [4-(4-hexylcyclohexyl)phenyl] 4-(3-prop-2-enoyloxypropoxy)cyclohexane-1-carboxylate.
| Compound Name | [4-(4-hexylcyclohexyl)phenyl] 4-(3-prop-2-enoyloxypropoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 147715552 |
| Molecular Formula | C31H46O5 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | [4-(4-hexylcyclohexyl)phenyl] 4-(3-prop-2-enoyloxypropoxy)cyclohexane-1-carboxylate |
| SMILES | C=CC(=O)OCCCOC1CCC(C(=O)Oc2ccc(C3CCC(CCCCCC)CC3)cc2)CC1 |
| InChI | InChI=1S/C31H46O5/c1-3-5-6-7-9-24-10-12-25(13-11-24)26-14-20-29(21-15-26)36-31(33)27-16-18-28(19-17-27)34-22-8-23-35-30(32)4-2/h4,14-15,20-21,24-25,27-28H,2-3,5-13,16-19,22-23H2,1H3 |
| InChIKey | GVOCUSAJDDFTJO-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|