C26H40O3 — CID 21036152
6-[4-(4-pentylcyclohexyl)phenoxy]hexyl prop-2-enoate (PubChem CID 21036152) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is 6-[4-(4-pentylcyclohexyl)phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-(4-pentylcyclohexyl)phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 21036152 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | 6-[4-(4-pentylcyclohexyl)phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C2CCC(CCCCC)CC2)cc1 |
| InChI | InChI=1S/C26H40O3/c1-3-5-8-11-22-12-14-23(15-13-22)24-16-18-25(19-17-24)28-20-9-6-7-10-21-29-26(27)4-2/h4,16-19,22-23H,2-3,5-15,20-21H2,1H3 |
| InChIKey | WISIFBJFVYNFHM-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|