C24H32O5 — CID 58185084
6-[4-(4-prop-2-enoyloxycyclohexyl)phenoxy]hexyl prop-2-enoate (PubChem CID 58185084) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is 6-[4-(4-prop-2-enoyloxycyclohexyl)phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-(4-prop-2-enoyloxycyclohexyl)phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 58185084 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 6-[4-(4-prop-2-enoyloxycyclohexyl)phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C2CCC(OC(=O)C=C)CC2)cc1 |
| InChI | InChI=1S/C24H32O5/c1-3-23(25)28-18-8-6-5-7-17-27-21-13-9-19(10-14-21)20-11-15-22(16-12-20)29-24(26)4-2/h3-4,9-10,13-14,20,22H,1-2,5-8,11-12,15-18H2 |
| InChIKey | CVCOVKCHHDOSJQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|