C35H42O3 — CID 144623901
6-[4-[4-[3-methyl-4-(4-methylphenyl)phenyl]cyclohexyl]phenoxy]hexyl prop-2-enoate (PubChem CID 144623901) has the molecular formula C35H42O3 and a molecular weight of 510.72 g/mol. Its IUPAC name is 6-[4-[4-[3-methyl-4-(4-methylphenyl)phenyl]cyclohexyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[4-[3-methyl-4-(4-methylphenyl)phenyl]cyclohexyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 144623901 |
| Molecular Formula | C35H42O3 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | 6-[4-[4-[3-methyl-4-(4-methylphenyl)phenyl]cyclohexyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C2CCC(c3ccc(-c4ccc(C)cc4)c(C)c3)CC2)cc1 |
| InChI | InChI=1S/C35H42O3/c1-4-35(36)38-24-8-6-5-7-23-37-33-20-17-29(18-21-33)28-13-15-30(16-14-28)32-19-22-34(27(3)25-32)31-11-9-26(2)10-12-31/h4,9-12,17-22,25,28,30H,1,5-8,13-16,23-24H2,2-3H3 |
| InChIKey | VKDSAOBIWWYVRU-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|