C30H40O3 — CID 161214482
6-[4-[2-[4-(4-methylcyclohexyl)phenyl]ethyl]phenoxy]hexyl prop-2-enoate (PubChem CID 161214482) has the molecular formula C30H40O3 and a molecular weight of 448.65 g/mol. Its IUPAC name is 6-[4-[2-[4-(4-methylcyclohexyl)phenyl]ethyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[2-[4-(4-methylcyclohexyl)phenyl]ethyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 161214482 |
| Molecular Formula | C30H40O3 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | 6-[4-[2-[4-(4-methylcyclohexyl)phenyl]ethyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(CCc2ccc(C3CCC(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H40O3/c1-3-30(31)33-23-7-5-4-6-22-32-29-20-14-26(15-21-29)11-10-25-12-18-28(19-13-25)27-16-8-24(2)9-17-27/h3,12-15,18-21,24,27H,1,4-11,16-17,22-23H2,2H3 |
| InChIKey | MGQNXTAJLXADDG-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|