C25H34O6 — CID 135188765
4-[3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoyl]cyclohexane-1-carboxylic acid (PubChem CID 135188765) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is 4-[3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 135188765 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 4-[3-[4-(6-prop-2-enoyloxyhexoxy)phenyl]propanoyl]cyclohexane-1-carboxylic acid |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(CCC(=O)C2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C25H34O6/c1-2-24(27)31-18-6-4-3-5-17-30-22-14-7-19(8-15-22)9-16-23(26)20-10-12-21(13-11-20)25(28)29/h2,7-8,14-15,20-21H,1,3-6,9-13,16-18H2,(H,28,29) |
| InChIKey | XKSSBAZVZIZEKZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|